C24H20BrF2N2O5PS2 — CID 11657416
[[2-bromo-4-[(N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]anilino)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11657416) has the molecular formula C24H20BrF2N2O5PS2 and a molecular weight of 629.44 g/mol. Its IUPAC name is [[2-bromo-4-[(N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]anilino)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11657416 |
| Molecular Formula | C24H20BrF2N2O5PS2 |
| Molecular Weight | 629.44 g/mol |
| Exact Mass | 627.97 |
| IUPAC Name | [[2-bromo-4-[(N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2csc(N(Cc3ccc(C(F)(F)P(=O)(O)O)c(Br)c3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H20BrF2N2O5PS2/c1-37(33,34)19-10-8-17(9-11-19)22-15-36-23(28-22)29(18-5-3-2-4-6-18)14-16-7-12-20(21(25)13-16)24(26,27)35(30,31)32/h2-13,15H,14H2,1H3,(H2,30,31,32) |
| InChIKey | UJBLOWGVJNVIEX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|