C31H28BrCl2F2N2O3PS — CID 69257621
[[2-bromo-4-[(3,4-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid;butane (PubChem CID 69257621) has the molecular formula C31H28BrCl2F2N2O3PS and a molecular weight of 728.42 g/mol. Its IUPAC name is [[2-bromo-4-[(3,4-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid;butane.
| Compound Name | [[2-bromo-4-[(3,4-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid;butane |
|---|---|
| PubChem CID | 69257621 |
| Molecular Formula | C31H28BrCl2F2N2O3PS |
| Molecular Weight | 728.42 g/mol |
| Exact Mass | 726.01 |
| IUPAC Name | [[2-bromo-4-[(3,4-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid;butane |
| SMILES | CCCC.O=P(O)(O)C(F)(F)c1ccc(CN(c2ccc(Cl)c(Cl)c2)c2nc(-c3ccc4ccccc4c3)cs2)cc1Br |
| InChI | InChI=1S/C27H18BrCl2F2N2O3PS.C4H10/c28-22-11-16(5-9-21(22)27(31,32)38(35,36)37)14-34(20-8-10-23(29)24(30)13-20)26-33-25(15-39-26)19-7-6-17-3-1-2-4-18(17)12-19;1-3-4-2/h1-13,15H,14H2,(H2,35,36,37);3-4H2,1-2H3 |
| InChIKey | WKMCYMBYFUSYBT-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.42 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|