C24H21BrCl2F2NO7PS — CID 11571150
3-[4-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl-[(3,4-dichlorophenyl)methyl]sulfamoyl]phenyl]propanoic acid (PubChem CID 11571150) has the molecular formula C24H21BrCl2F2NO7PS and a molecular weight of 687.28 g/mol. Its IUPAC name is 3-[4-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl-[(3,4-dichlorophenyl)methyl]sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl-[(3,4-dichlorophenyl)methyl]sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11571150 |
| Molecular Formula | C24H21BrCl2F2NO7PS |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 684.93 |
| IUPAC Name | 3-[4-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl-[(3,4-dichlorophenyl)methyl]sulfamoyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(S(=O)(=O)N(Cc2ccc(Cl)c(Cl)c2)Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)cc1 |
| InChI | InChI=1S/C24H21BrCl2F2NO7PS/c25-20-11-16(3-8-19(20)24(28,29)38(33,34)35)13-30(14-17-4-9-21(26)22(27)12-17)39(36,37)18-6-1-15(2-7-18)5-10-23(31)32/h1-4,6-9,11-12H,5,10,13-14H2,(H,31,32)(H2,33,34,35) |
| InChIKey | XHNNVCWDPWRJDL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|