C22H17Br2NO6S — CID 11599568
4-[[benzenesulfonyl-[(3-bromo-4-carboxyphenyl)methyl]amino]methyl]-2-bromobenzoic acid (PubChem CID 11599568) has the molecular formula C22H17Br2NO6S and a molecular weight of 583.25 g/mol. Its IUPAC name is 4-[[benzenesulfonyl-[(3-bromo-4-carboxyphenyl)methyl]amino]methyl]-2-bromobenzoic acid.
| Compound Name | 4-[[benzenesulfonyl-[(3-bromo-4-carboxyphenyl)methyl]amino]methyl]-2-bromobenzoic acid |
|---|---|
| PubChem CID | 11599568 |
| Molecular Formula | C22H17Br2NO6S |
| Molecular Weight | 583.25 g/mol |
| Exact Mass | 580.91 |
| IUPAC Name | 4-[[benzenesulfonyl-[(3-bromo-4-carboxyphenyl)methyl]amino]methyl]-2-bromobenzoic acid |
| SMILES | O=C(O)c1ccc(CN(Cc2ccc(C(=O)O)c(Br)c2)S(=O)(=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C22H17Br2NO6S/c23-19-10-14(6-8-17(19)21(26)27)12-25(32(30,31)16-4-2-1-3-5-16)13-15-7-9-18(22(28)29)20(24)11-15/h1-11H,12-13H2,(H,26,27)(H,28,29) |
| InChIKey | GZLVMKSWNOSXLY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |