C16H15F2NO3S — CID 17420018
N-[(2-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfonylpropanamide (PubChem CID 17420018) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfonylpropanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 17420018 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1F)NCc1ccccc1F |
| InChI | InChI=1S/C16H15F2NO3S/c17-13-6-2-1-5-12(13)11-19-16(20)9-10-23(21,22)15-8-4-3-7-14(15)18/h1-8H,9-11H2,(H,19,20) |
| InChIKey | GEUWJEIDXQUJMC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |