C19H20ClN3O7S — CID 2430695
[2-(2-benzoylhydrazinyl)-2-oxoethyl] (2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate (PubChem CID 2430695) has the molecular formula C19H20ClN3O7S and a molecular weight of 469.90 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] (2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 2430695 |
| Molecular Formula | C19H20ClN3O7S |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (2R,3S)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
| SMILES | C[C@H](O)[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCC(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20ClN3O7S/c1-12(24)17(23-31(28,29)15-9-7-14(20)8-10-15)19(27)30-11-16(25)21-22-18(26)13-5-3-2-4-6-13/h2-10,12,17,23-24H,11H2,1H3,(H,21,25)(H,22,26)/t12-,17+/m0/s1 |
| InChIKey | IDUWUSQLOJBXND-YVEFUNNKSA-N |
| XLogP | 0.37 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|