C18H17ClN2O4S — CID 7806440
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 7806440) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806440 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)OCC(=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O4S/c1-12(26-15-5-3-2-4-6-15)18(24)25-11-16(22)20-21-17(23)13-7-9-14(19)10-8-13/h2-10,12H,11H2,1H3,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | QQBSQFBFDJUUNJ-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|