C22H19ClN2O4S — CID 24676607
N-benzyl-2-[[2-(4-chlorophenyl)sulfonylacetyl]amino]benzamide (PubChem CID 24676607) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-chlorophenyl)sulfonylacetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-(4-chlorophenyl)sulfonylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 24676607 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-benzyl-2-[[2-(4-chlorophenyl)sulfonylacetyl]amino]benzamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H19ClN2O4S/c23-17-10-12-18(13-11-17)30(28,29)15-21(26)25-20-9-5-4-8-19(20)22(27)24-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,24,27)(H,25,26) |
| InChIKey | NIFTVGUTSUXXTB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |