C28H23Cl2N3O4S — CID 126033575
2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]amino]-N-benzylbenzamide (PubChem CID 126033575) has the molecular formula C28H23Cl2N3O4S and a molecular weight of 568.48 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]amino]-N-benzylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]amino]-N-benzylbenzamide |
|---|---|
| PubChem CID | 126033575 |
| Molecular Formula | C28H23Cl2N3O4S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]amino]-N-benzylbenzamide |
| SMILES | O=C(CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H23Cl2N3O4S/c29-23-15-9-17-25(27(23)30)33(38(36,37)21-12-5-2-6-13-21)19-26(34)32-24-16-8-7-14-22(24)28(35)31-18-20-10-3-1-4-11-20/h1-17H,18-19H2,(H,31,35)(H,32,34) |
| InChIKey | ZAENWXQBJYUWRF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |