C31H31N3O5S — CID 126031358
N-benzyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 126031358) has the molecular formula C31H31N3O5S and a molecular weight of 557.67 g/mol. Its IUPAC name is N-benzyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126031358 |
| Molecular Formula | C31H31N3O5S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | N-benzyl-2-[[2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccccc1C(=O)NCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H31N3O5S/c1-3-39-29-16-10-9-15-28(29)34(40(37,38)25-19-17-23(2)18-20-25)22-30(35)33-27-14-8-7-13-26(27)31(36)32-21-24-11-5-4-6-12-24/h4-20H,3,21-22H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | NWJPSWAYEAYOTH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |