C30H29N3O4S — CID 126029957
N-benzyl-2-[[2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 126029957) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is N-benzyl-2-[[2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126029957 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-benzyl-2-[[2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2C(=O)NCc2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C30H29N3O4S/c1-22-16-18-25(19-17-22)38(36,37)33(28-15-9-6-10-23(28)2)21-29(34)32-27-14-8-7-13-26(27)30(35)31-20-24-11-4-3-5-12-24/h3-19H,20-21H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | SVHWCVDZDMRUPE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |