C18H16ClN3O3S — CID 27161179
N-(5-chloro-2-pyridinyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide (PubChem CID 27161179) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 27161179 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cn1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-22(12-18(23)21-17-9-7-15(19)11-20-17)26(24,25)16-8-6-13-4-2-3-5-14(13)10-16/h2-11H,12H2,1H3,(H,20,21,23) |
| InChIKey | ROPKRIHTZFAFEB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |