C19H16Cl2N2O3S — CID 45375147
N-(3,5-dichlorophenyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide (PubChem CID 45375147) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 45375147 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-23(12-19(24)22-17-10-15(20)9-16(21)11-17)27(25,26)18-7-6-13-4-2-3-5-14(13)8-18/h2-11H,12H2,1H3,(H,22,24) |
| InChIKey | YOFUUGRUJFZKLR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |