C24H23N3O5S — CID 24684358
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide (PubChem CID 24684358) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 24684358 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[methyl(naphthalen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(CN2C(=O)CCC2=O)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23N3O5S/c1-26(33(31,32)21-11-8-18-4-2-3-5-19(18)14-21)16-22(28)25-20-9-6-17(7-10-20)15-27-23(29)12-13-24(27)30/h2-11,14H,12-13,15-16H2,1H3,(H,25,28) |
| InChIKey | BUHCLGKAYSSBPL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|