C17H15ClFNO3S — CID 7355331
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7355331) has the molecular formula C17H15ClFNO3S and a molecular weight of 367.83 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7355331 |
| Molecular Formula | C17H15ClFNO3S |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccccc1F)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H15ClFNO3S/c18-13-6-2-1-5-12(13)9-20-16(21)10-23-17(22)11-24-15-8-4-3-7-14(15)19/h1-8H,9-11H2,(H,20,21) |
| InChIKey | AWDWUHZRZPJAMI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |