C16H13Cl2NO3 — CID 2624351
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chlorobenzoate (PubChem CID 2624351) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chlorobenzoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2624351 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO3/c17-13-7-3-1-5-11(13)9-19-15(20)10-22-16(21)12-6-2-4-8-14(12)18/h1-8H,9-10H2,(H,19,20) |
| InChIKey | IEBCARCFKNYQBV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |