C17H15Cl2NO5S — CID 2503054
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2503054) has the molecular formula C17H15Cl2NO5S and a molecular weight of 416.28 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2503054 |
| Molecular Formula | C17H15Cl2NO5S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO5S/c1-26(23,24)12-6-7-15(19)13(8-12)17(22)25-10-16(21)20-9-11-4-2-3-5-14(11)18/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | IOHNOABRLSGDEG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |