C15H19ClN2O6S — CID 2502861
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2502861) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2502861 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C15H19ClN2O6S/c1-9(2)7-17-15(21)18-13(19)8-24-14(20)11-6-10(25(3,22)23)4-5-12(11)16/h4-6,9H,7-8H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | YXKQBBLTRGSPGZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |