C18H26ClNO5S — CID 55311680
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 55311680) has the molecular formula C18H26ClNO5S and a molecular weight of 403.93 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55311680 |
| Molecular Formula | C18H26ClNO5S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C18H26ClNO5S/c1-12(2)9-20(10-13(3)4)17(21)11-25-18(22)15-8-14(26(5,23)24)6-7-16(15)19/h6-8,12-13H,9-11H2,1-5H3 |
| InChIKey | LWPJIDVUDFERCT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |