C18H14ClF3N2O4S — CID 30471131
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-(2-chlorophenyl)sulfanylacetate (PubChem CID 30471131) has the molecular formula C18H14ClF3N2O4S and a molecular weight of 446.83 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-(2-chlorophenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-(2-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 30471131 |
| Molecular Formula | C18H14ClF3N2O4S |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 2-(2-chlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccccc1Cl)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14ClF3N2O4S/c19-10-3-1-2-4-13(10)29-9-16(27)28-8-15(26)23-7-14(25)24-12-6-5-11(20)17(21)18(12)22/h1-6H,7-9H2,(H,23,26)(H,24,25) |
| InChIKey | DIWAZNLAPZFIOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|