C18H11ClF3NOS — CID 4531318
2-(8-chloronaphthalen-1-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4531318) has the molecular formula C18H11ClF3NOS and a molecular weight of 381.81 g/mol. Its IUPAC name is 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4531318 |
| Molecular Formula | C18H11ClF3NOS |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-(8-chloronaphthalen-1-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11ClF3NOS/c19-11-5-1-3-10-4-2-6-14(16(10)11)25-9-15(24)23-13-8-7-12(20)17(21)18(13)22/h1-8H,9H2,(H,23,24) |
| InChIKey | QRNXVGZGHAVAFE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|