C21H19ClN2O2S — CID 134019293
N-(3-acetamido-2-methylphenyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide (PubChem CID 134019293) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is N-(3-acetamido-2-methylphenyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide.
| Compound Name | N-(3-acetamido-2-methylphenyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 134019293 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-(3-acetamido-2-methylphenyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2cccc3cccc(Cl)c23)c1C |
| InChI | InChI=1S/C21H19ClN2O2S/c1-13-17(23-14(2)25)9-5-10-18(13)24-20(26)12-27-19-11-4-7-15-6-3-8-16(22)21(15)19/h3-11H,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | PSFGAAICSLFKPP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |