C19H14ClFN2O2S — CID 2093520
N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]-2-fluorobenzohydrazide (PubChem CID 2093520) has the molecular formula C19H14ClFN2O2S and a molecular weight of 388.85 g/mol. Its IUPAC name is N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 2093520 |
| Molecular Formula | C19H14ClFN2O2S |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]-2-fluorobenzohydrazide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H14ClFN2O2S/c20-14-8-3-5-12-6-4-10-16(18(12)14)26-11-17(24)22-23-19(25)13-7-1-2-9-15(13)21/h1-10H,11H2,(H,22,24)(H,23,25) |
| InChIKey | XFIZZOCSNGGWDR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|