C17H13ClN4O2S — CID 34438852
N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]pyrazine-2-carbohydrazide (PubChem CID 34438852) has the molecular formula C17H13ClN4O2S and a molecular weight of 372.84 g/mol. Its IUPAC name is N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 34438852 |
| Molecular Formula | C17H13ClN4O2S |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | N'-[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]pyrazine-2-carbohydrazide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C17H13ClN4O2S/c18-12-5-1-3-11-4-2-6-14(16(11)12)25-10-15(23)21-22-17(24)13-9-19-7-8-20-13/h1-9H,10H2,(H,21,23)(H,22,24) |
| InChIKey | GAGGXDZLNWZECJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|