C13H11Cl2N3S — CID 19686283
1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)thiourea (PubChem CID 19686283) has the molecular formula C13H11Cl2N3S and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)thiourea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19686283 |
| Molecular Formula | C13H11Cl2N3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-(5-chloro-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(Cl)cc1NC(=S)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11Cl2N3S/c1-8-2-3-9(14)6-11(8)17-13(19)18-12-5-4-10(15)7-16-12/h2-7H,1H3,(H2,16,17,18,19) |
| InChIKey | WLTIIYJYYDBSKN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|