C13H18ClN3OS — CID 7934514
1-[(Z)-1-(4-chlorophenyl)propylideneamino]-3-(2-methoxyethyl)thiourea (PubChem CID 7934514) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is 1-[(Z)-1-(4-chlorophenyl)propylideneamino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(Z)-1-(4-chlorophenyl)propylideneamino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 7934514 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(Z)-1-(4-chlorophenyl)propylideneamino]-3-(2-methoxyethyl)thiourea |
| SMILES | CC/C(=N/NC(=S)NCCOC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClN3OS/c1-3-12(10-4-6-11(14)7-5-10)16-17-13(19)15-8-9-18-2/h4-7H,3,8-9H2,1-2H3,(H2,15,17,19)/b16-12- |
| InChIKey | XAGLWIGWWBAXSI-VBKFSLOCSA-N |
| XLogP | 2.56 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|