C14H17BrN3O3S- — CID 8978967
(4Z)-4-(4-bromophenyl)-4-(2-methoxyethylcarbamothioylhydrazinylidene)butanoate (PubChem CID 8978967) has the molecular formula C14H17BrN3O3S- and a molecular weight of 387.28 g/mol. Its IUPAC name is (4Z)-4-(4-bromophenyl)-4-(2-methoxyethylcarbamothioylhydrazinylidene)butanoate.
| Compound Name | (4Z)-4-(4-bromophenyl)-4-(2-methoxyethylcarbamothioylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 8978967 |
| Molecular Formula | C14H17BrN3O3S- |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (4Z)-4-(4-bromophenyl)-4-(2-methoxyethylcarbamothioylhydrazinylidene)butanoate |
| SMILES | COCCNC(=S)N/N=C(/CCC(=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrN3O3S/c1-21-9-8-16-14(22)18-17-12(6-7-13(19)20)10-2-4-11(15)5-3-10/h2-5H,6-9H2,1H3,(H,19,20)(H2,16,18,22)/p-1/b17-12- |
| InChIKey | OLMWVZHEJUTJQL-ATVHPVEESA-M |
| XLogP | 0.79 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|