C20H16Cl2FN3O3S2 — CID 25040264
1-(4-chloro-3-fluorophenyl)-3-[4-[(4-chlorophenyl)sulfamoyl]-2-methoxyphenyl]thiourea (PubChem CID 25040264) has the molecular formula C20H16Cl2FN3O3S2 and a molecular weight of 500.40 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-[4-[(4-chlorophenyl)sulfamoyl]-2-methoxyphenyl]thiourea.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-[4-[(4-chlorophenyl)sulfamoyl]-2-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 25040264 |
| Molecular Formula | C20H16Cl2FN3O3S2 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-[4-[(4-chlorophenyl)sulfamoyl]-2-methoxyphenyl]thiourea |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1NC(=S)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H16Cl2FN3O3S2/c1-29-19-11-15(31(27,28)26-13-4-2-12(21)3-5-13)7-9-18(19)25-20(30)24-14-6-8-16(22)17(23)10-14/h2-11,26H,1H3,(H2,24,25,30) |
| InChIKey | NXYDVLWCGXBWND-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|