C16H20BrN3O3S — CID 127048839
1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine (PubChem CID 127048839) has the molecular formula C16H20BrN3O3S and a molecular weight of 414.33 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 127048839 |
| Molecular Formula | C16H20BrN3O3S |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(Cn3ccnc3)C2)cc1Br |
| InChI | InChI=1S/C16H20BrN3O3S/c1-23-16-5-4-14(9-15(16)17)24(21,22)20-7-2-3-13(11-20)10-19-8-6-18-12-19/h4-6,8-9,12-13H,2-3,7,10-11H2,1H3 |
| InChIKey | DCBBRMLZPYQDDR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |