C16H20FN3O2S — CID 127048841
1-(4-fluoro-2-methylphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine (PubChem CID 127048841) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 127048841 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-3-(imidazol-1-ylmethyl)piperidine |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCC(Cn2ccnc2)C1 |
| InChI | InChI=1S/C16H20FN3O2S/c1-13-9-15(17)4-5-16(13)23(21,22)20-7-2-3-14(11-20)10-19-8-6-18-12-19/h4-6,8-9,12,14H,2-3,7,10-11H2,1H3 |
| InChIKey | WIQFIIBVRAURMC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |