C19H21BrN2O5S — CID 23964874
[4-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-phenylmethanone (PubChem CID 23964874) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is [4-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23964874 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | [4-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-phenylmethanone |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2CCN(C(=O)c3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C19H21BrN2O5S/c1-26-16-13-17(27-2)18(12-15(16)20)28(24,25)22-10-8-21(9-11-22)19(23)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | MCJQEILFRYKVGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |