C21H22N2O7S — CID 55352650
dimethyl 2-(4-benzoylpiperazin-1-yl)sulfonylbenzene-1,4-dicarboxylate (PubChem CID 55352650) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is dimethyl 2-(4-benzoylpiperazin-1-yl)sulfonylbenzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-benzoylpiperazin-1-yl)sulfonylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55352650 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | dimethyl 2-(4-benzoylpiperazin-1-yl)sulfonylbenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)N2CCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H22N2O7S/c1-29-20(25)16-8-9-17(21(26)30-2)18(14-16)31(27,28)23-12-10-22(11-13-23)19(24)15-6-4-3-5-7-15/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | SRKGKVOKNUZHAR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |