C15H20N2O6S — CID 119959481
dimethyl 2-(3-aminopiperidin-1-yl)sulfonylbenzene-1,4-dicarboxylate (PubChem CID 119959481) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is dimethyl 2-(3-aminopiperidin-1-yl)sulfonylbenzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(3-aminopiperidin-1-yl)sulfonylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 119959481 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | dimethyl 2-(3-aminopiperidin-1-yl)sulfonylbenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)N2CCCC(N)C2)c1 |
| InChI | InChI=1S/C15H20N2O6S/c1-22-14(18)10-5-6-12(15(19)23-2)13(8-10)24(20,21)17-7-3-4-11(16)9-17/h5-6,8,11H,3-4,7,9,16H2,1-2H3 |
| InChIKey | FPHNJVAPSLWCQM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |