C14H21ClN2O4S — CID 119959935
methyl 5-(3-aminopiperidin-1-yl)sulfonyl-2-methylbenzoate;hydrochloride (PubChem CID 119959935) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is methyl 5-(3-aminopiperidin-1-yl)sulfonyl-2-methylbenzoate;hydrochloride.
| Compound Name | methyl 5-(3-aminopiperidin-1-yl)sulfonyl-2-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119959935 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 5-(3-aminopiperidin-1-yl)sulfonyl-2-methylbenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCCC(N)C2)ccc1C.Cl |
| InChI | InChI=1S/C14H20N2O4S.ClH/c1-10-5-6-12(8-13(10)14(17)20-2)21(18,19)16-7-3-4-11(15)9-16;/h5-6,8,11H,3-4,7,9,15H2,1-2H3;1H |
| InChIKey | KBBRSEGZNSDRME-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |