C18H21N3O5S — CID 110364631
[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-pyridin-3-ylmethanone (PubChem CID 110364631) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is [4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110364631 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-pyridin-3-ylmethanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3cccnc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O5S/c1-25-15-5-6-17(16(12-15)26-2)27(23,24)21-10-8-20(9-11-21)18(22)14-4-3-7-19-13-14/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | RRRKADISAATTCG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |