C20H21N2O6S- — CID 2052004
3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-1-carbonyl]benzoate (PubChem CID 2052004) has the molecular formula C20H21N2O6S- and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-1-carbonyl]benzoate.
| Compound Name | 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 2052004 |
| Molecular Formula | C20H21N2O6S- |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-1-carbonyl]benzoate |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCN(C(=O)c2cccc(C(=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H22N2O6S/c1-14-6-7-17(28-2)18(12-14)29(26,27)22-10-8-21(9-11-22)19(23)15-4-3-5-16(13-15)20(24)25/h3-7,12-13H,8-11H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | LAPFIXNGSKKAMH-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |