C23H29N3O4S — CID 24533466
(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone (PubChem CID 24533466) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is (4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24533466 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)-[4-(3-methylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3cccc(C)c3)CC2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C23H29N3O4S/c1-18-6-5-7-20(16-18)24-12-14-25(15-13-24)23(27)19-8-9-21(30-2)22(17-19)31(28,29)26-10-3-4-11-26/h5-9,16-17H,3-4,10-15H2,1-2H3 |
| InChIKey | IIFXIMKWJOZHJA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |