C16H25ClN2O3S — CID 55603646
5-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylbenzenesulfonamide (PubChem CID 55603646) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is 5-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55603646 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 5-chloro-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H25ClN2O3S/c1-12-5-6-15(17)9-16(12)23(20,21)18-7-4-8-19-10-13(2)22-14(3)11-19/h5-6,9,13-14,18H,4,7-8,10-11H2,1-3H3 |
| InChIKey | ZVCSBUFUVYJCAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|