C13H11F2NO3S — CID 81241598
N-[(2,4-difluorophenyl)methyl]-2-hydroxybenzenesulfonamide (PubChem CID 81241598) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-hydroxybenzenesulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81241598 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(F)cc1F)c1ccccc1O |
| InChI | InChI=1S/C13H11F2NO3S/c14-10-6-5-9(11(15)7-10)8-16-20(18,19)13-4-2-1-3-12(13)17/h1-7,16-17H,8H2 |
| InChIKey | KCTZSSQIBIMDNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |