C10H8BrFN2O4S3 — CID 60550023
5-bromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 60550023) has the molecular formula C10H8BrFN2O4S3 and a molecular weight of 415.29 g/mol. Its IUPAC name is 5-bromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60550023 |
| Molecular Formula | C10H8BrFN2O4S3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | 5-bromo-N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(Br)s2)c(F)c1 |
| InChI | InChI=1S/C10H8BrFN2O4S3/c11-9-3-4-10(19-9)21(17,18)14-8-2-1-6(5-7(8)12)20(13,15)16/h1-5,14H,(H2,13,15,16) |
| InChIKey | CJLSWGZVZWYCNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |