C9H8ClN3O4S2 — CID 106313993
5-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 106313993) has the molecular formula C9H8ClN3O4S2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 5-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106313993 |
| Molecular Formula | C9H8ClN3O4S2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 5-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)Nc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C9H8ClN3O4S2/c1-13-8(5(10)4-11-13)19(16,17)12-7-3-2-6(18-7)9(14)15/h2-4,12H,1H3,(H,14,15) |
| InChIKey | PIGKVOHRVODWKN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |