C9H16N4O3S2 — CID 104978674
N-[1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethylidene]hydroxylamine (PubChem CID 104978674) has the molecular formula C9H16N4O3S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is N-[1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 104978674 |
| Molecular Formula | C9H16N4O3S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-[1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1csc(NS(=O)(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C9H16N4O3S2/c1-6(2)4-10-18(15,16)13-9-11-8(5-17-9)7(3)12-14/h5-6,10,14H,4H2,1-3H3,(H,11,13) |
| InChIKey | YPCPJOPGUBKUMY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|