C9H15N3O3S2 — CID 114815388
1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethanone (PubChem CID 114815388) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 114815388 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-[2-(2-methylpropylsulfamoylamino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(NS(=O)(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C9H15N3O3S2/c1-6(2)4-10-17(14,15)12-9-11-8(5-16-9)7(3)13/h5-6,10H,4H2,1-3H3,(H,11,12) |
| InChIKey | SWGVUGJIJGDCDJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |