C11H13N3O3S3 — CID 77047038
5-ethyl-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide (PubChem CID 77047038) has the molecular formula C11H13N3O3S3 and a molecular weight of 331.44 g/mol. Its IUPAC name is 5-ethyl-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 77047038 |
| Molecular Formula | C11H13N3O3S3 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 5-ethyl-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2nc(C(C)=NO)cs2)s1 |
| InChI | InChI=1S/C11H13N3O3S3/c1-3-8-4-5-10(19-8)20(16,17)14-11-12-9(6-18-11)7(2)13-15/h4-6,15H,3H2,1-2H3,(H,12,14) |
| InChIKey | ICIZEBAZJKPBNY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|