C13H18N2O2S — CID 60717010
N-(4-acetyl-1,3-thiazol-2-yl)-2-cyclohexylacetamide (PubChem CID 60717010) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-2-cyclohexylacetamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 60717010 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-cyclohexylacetamide |
| SMILES | CC(=O)c1csc(NC(=O)CC2CCCCC2)n1 |
| InChI | InChI=1S/C13H18N2O2S/c1-9(16)11-8-18-13(14-11)15-12(17)7-10-5-3-2-4-6-10/h8,10H,2-7H2,1H3,(H,14,15,17) |
| InChIKey | FNWIJZJJBLPGLJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |