C21H15BrN2OS — CID 16849308
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-ylacetamide (PubChem CID 16849308) has the molecular formula C21H15BrN2OS and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16849308 |
| Molecular Formula | C21H15BrN2OS |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C21H15BrN2OS/c22-18-9-7-16(8-10-18)19-13-26-21(23-19)24-20(25)12-14-5-6-15-3-1-2-4-17(15)11-14/h1-11,13H,12H2,(H,23,24,25) |
| InChIKey | YERCJCAXRWMWJB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |