C20H16N2O2S3 — CID 7918511
N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)acetamide (PubChem CID 7918511) has the molecular formula C20H16N2O2S3 and a molecular weight of 412.56 g/mol. Its IUPAC name is N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7918511 |
| Molecular Formula | C20H16N2O2S3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nc(-c3cccs3)c(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C20H16N2O2S3/c1-24-14-8-6-13(7-9-14)12-17(23)21-20-22-18(15-4-2-10-25-15)19(27-20)16-5-3-11-26-16/h2-11H,12H2,1H3,(H,21,22,23) |
| InChIKey | KLTCAHCWYVSNHI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |