C16H14N2O2S3 — CID 4877560
N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)oxolane-2-carboxamide (PubChem CID 4877560) has the molecular formula C16H14N2O2S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)oxolane-2-carboxamide.
| Compound Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4877560 |
| Molecular Formula | C16H14N2O2S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccs2)c(-c2cccs2)s1)C1CCCO1 |
| InChI | InChI=1S/C16H14N2O2S3/c19-15(10-4-1-7-20-10)18-16-17-13(11-5-2-8-21-11)14(23-16)12-6-3-9-22-12/h2-3,5-6,8-10H,1,4,7H2,(H,17,18,19) |
| InChIKey | GJADXNJXJXPQAP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |