C19H21N3S2 — CID 3848615
1-(2,6-diethylphenyl)-3-(2-methyl-1,3-benzothiazol-5-yl)thiourea (PubChem CID 3848615) has the molecular formula C19H21N3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-(2-methyl-1,3-benzothiazol-5-yl)thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-(2-methyl-1,3-benzothiazol-5-yl)thiourea |
|---|---|
| PubChem CID | 3848615 |
| Molecular Formula | C19H21N3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-(2-methyl-1,3-benzothiazol-5-yl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)Nc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C19H21N3S2/c1-4-13-7-6-8-14(5-2)18(13)22-19(23)21-15-9-10-17-16(11-15)20-12(3)24-17/h6-11H,4-5H2,1-3H3,(H2,21,22,23) |
| InChIKey | NGGGWUXCFSDHRO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|