C16H17N5O3S2 — CID 70088664
tert-butyl 2-[[5-[(3-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 70088664) has the molecular formula C16H17N5O3S2 and a molecular weight of 391.48 g/mol. Its IUPAC name is tert-butyl 2-[[5-[(3-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | tert-butyl 2-[[5-[(3-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 70088664 |
| Molecular Formula | C16H17N5O3S2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | tert-butyl 2-[[5-[(3-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CC(C)(C)OC(=O)CSc1nnc(NC(=O)Nc2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C16H17N5O3S2/c1-16(2,3)24-12(22)9-25-15-21-20-14(26-15)19-13(23)18-11-6-4-5-10(7-11)8-17/h4-7H,9H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | DEJSWFCGCRWZTF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|